C23H37BN2O6S — CID 165180604
tert-butyl (2R)-2-methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 165180604) has the molecular formula C23H37BN2O6S and a molecular weight of 480.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 165180604 |
| Molecular Formula | C23H37BN2O6S |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl (2R)-2-methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)N2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)c1 |
| InChI | InChI=1S/C23H37BN2O6S/c1-16-12-18(24-31-22(6,7)23(8,9)32-24)14-19(13-16)33(28,29)25-10-11-26(17(2)15-25)20(27)30-21(3,4)5/h12-14,17H,10-11,15H2,1-9H3/t17-/m1/s1 |
| InChIKey | KFLYLOJVTMDMDV-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|