C45H72NO10P — CID 165180987
3-[[3-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(Z)-tridec-9-enoyl]amino]propanoic acid (PubChem CID 165180987) has the molecular formula C45H72NO10P and a molecular weight of 818.04 g/mol. Its IUPAC name is 3-[[3-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(Z)-tridec-9-enoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(Z)-tridec-9-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165180987 |
| Molecular Formula | C45H72NO10P |
| Molecular Weight | 818.04 g/mol |
| Exact Mass | 817.49 |
| IUPAC Name | 3-[[3-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(Z)-tridec-9-enoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(O)COP(=O)(O)OCC(NC(=O)CCCCCCC/C=C\CCC)C(=O)O |
| InChI | InChI=1S/C45H72NO10P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-44(49)54-38-41(47)39-55-57(52,53)56-40-42(45(50)51)46-43(48)36-34-32-30-28-14-12-10-8-6-4-2/h5,7-8,10-11,13,16-17,19-20,22-23,25-26,29,31,41-42,47H,3-4,6,9,12,14-15,18,21,24,27-28,30,32-40H2,1-2H3,(H,46,48)(H,50,51)(H,52,53)/b7-5-,10-8-,13-11-,17-16-,20-19-,23-22-,26-25-,31-29- |
| InChIKey | ABBPHHOZSBXQGW-AMCYNPBVSA-N |
| XLogP | 10.49 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.04 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|