C35H67N2O6P — CID 165182432
2-aminoethyl [(E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate (PubChem CID 165182432) has the molecular formula C35H67N2O6P and a molecular weight of 642.90 g/mol. Its IUPAC name is 2-aminoethyl [(E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165182432 |
| Molecular Formula | C35H67N2O6P |
| Molecular Weight | 642.90 g/mol |
| Exact Mass | 642.47 |
| IUPAC Name | 2-aminoethyl [(E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxydodec-4-enyl] hydrogen phosphate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CCCCCCC |
| InChI | InChI=1S/C35H67N2O6P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-27-29-35(39)37-33(32-43-44(40,41)42-31-30-36)34(38)28-26-24-22-10-8-6-4-2/h12-13,15-16,26,28,33-34,38H,3-11,14,17-25,27,29-32,36H2,1-2H3,(H,37,39)(H,40,41)/b13-12-,16-15-,28-26+ |
| InChIKey | AGYGGXJSJRYGHB-VDLBIVBBSA-N |
| XLogP | 8.82 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.90 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|