C15H30NO8P — CID 165184690
[3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] butanoate (PubChem CID 165184690) has the molecular formula C15H30NO8P and a molecular weight of 383.38 g/mol. Its IUPAC name is [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] butanoate.
| Compound Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 165184690 |
| Molecular Formula | C15H30NO8P |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] butanoate |
| SMILES | CCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCC |
| InChI | InChI=1S/C15H30NO8P/c1-3-5-6-8-14(18)16-9-10-23-25(20,21)24-12-13(17)11-22-15(19)7-4-2/h13,17H,3-12H2,1-2H3,(H,16,18)(H,20,21) |
| InChIKey | AQFMBVLKPOUMSW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|