C17H34NO8P — CID 165185078
[2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] nonanoate (PubChem CID 165185078) has the molecular formula C17H34NO8P and a molecular weight of 411.43 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] nonanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] nonanoate |
|---|---|
| PubChem CID | 165185078 |
| Molecular Formula | C17H34NO8P |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CC |
| InChI | InChI=1S/C17H34NO8P/c1-3-5-6-7-8-9-10-17(21)24-13-15(19)14-26-27(22,23)25-12-11-18-16(20)4-2/h15,19H,3-14H2,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | ARSLKKMYZPKAAU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|