C33H64NO9P — CID 165189950
2-amino-3-[[2-decanoyloxy-3-[(Z)-heptadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165189950) has the molecular formula C33H64NO9P and a molecular weight of 649.85 g/mol. Its IUPAC name is 2-amino-3-[[2-decanoyloxy-3-[(Z)-heptadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[2-decanoyloxy-3-[(Z)-heptadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165189950 |
| Molecular Formula | C33H64NO9P |
| Molecular Weight | 649.85 g/mol |
| Exact Mass | 649.43 |
| IUPAC Name | 2-amino-3-[[2-decanoyloxy-3-[(Z)-heptadec-9-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCC/C=C\CCCCCCCCOCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H64NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-40-27-30(28-41-44(38,39)42-29-31(34)33(36)37)43-32(35)25-23-21-19-10-8-6-4-2/h13-14,30-31H,3-12,15-29,34H2,1-2H3,(H,36,37)(H,38,39)/b14-13- |
| InChIKey | BKOQEJGHIDSYGG-YPKPFQOOSA-N |
| XLogP | 8.25 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.85 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|