C67H112O6 — CID 165190405
2,3-bis[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy]propyl (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate (PubChem CID 165190405) has the molecular formula C67H112O6 and a molecular weight of 1013.63 g/mol. Its IUPAC name is 2,3-bis[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy]propyl (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate.
| Compound Name | 2,3-bis[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy]propyl (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 165190405 |
| Molecular Formula | C67H112O6 |
| Molecular Weight | 1013.63 g/mol |
| Exact Mass | 1012.85 |
| IUPAC Name | 2,3-bis[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy]propyl (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCCCC)OC(=O)CCCCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C67H112O6/c1-4-7-10-13-16-19-22-25-28-31-32-33-34-37-39-42-45-48-51-54-57-60-66(69)72-63-64(73-67(70)61-58-55-52-49-46-43-40-36-30-27-24-21-18-15-12-9-6-3)62-71-65(68)59-56-53-50-47-44-41-38-35-29-26-23-20-17-14-11-8-5-2/h8-9,11-12,17-18,20-22,25-27,29-32,34,37,64H,4-7,10,13-16,19,23-24,28,33,35-36,38-63H2,1-3H3/b11-8-,12-9-,20-17-,21-18-,25-22-,29-26-,30-27-,32-31-,37-34- |
| InChIKey | BMMNCXUMCTUMOO-WHUWAHIDSA-N |
| XLogP | 20.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.63 |
| LogP ≤ 5 | 20.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|