C20H40NO8P — CID 165193978
[2-hydroxy-3-[hydroxy-[2-(pentanoylamino)ethoxy]phosphoryl]oxypropyl] decanoate (PubChem CID 165193978) has the molecular formula C20H40NO8P and a molecular weight of 453.51 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-(pentanoylamino)ethoxy]phosphoryl]oxypropyl] decanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-(pentanoylamino)ethoxy]phosphoryl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 165193978 |
| Molecular Formula | C20H40NO8P |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-(pentanoylamino)ethoxy]phosphoryl]oxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCC |
| InChI | InChI=1S/C20H40NO8P/c1-3-5-7-8-9-10-11-13-20(24)27-16-18(22)17-29-30(25,26)28-15-14-21-19(23)12-6-4-2/h18,22H,3-17H2,1-2H3,(H,21,23)(H,25,26) |
| InChIKey | CBBVKPAYRNZJKZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|