C24H51NO7P+ — CID 165195164
2-[(3-decoxy-2-hexanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165195164) has the molecular formula C24H51NO7P+ and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[(3-decoxy-2-hexanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(3-decoxy-2-hexanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165195164 |
| Molecular Formula | C24H51NO7P+ |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 2-[(3-decoxy-2-hexanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C24H50NO7P/c1-6-8-10-11-12-13-14-16-19-29-21-23(32-24(26)17-15-9-7-2)22-31-33(27,28)30-20-18-25(3,4)5/h23H,6-22H2,1-5H3/p+1 |
| InChIKey | CFVGUUZHLUBWRM-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|