C36H60NO10P — CID 165195567
3-[(3-decanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]propanoic acid (PubChem CID 165195567) has the molecular formula C36H60NO10P and a molecular weight of 697.85 g/mol. Its IUPAC name is 3-[(3-decanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]propanoic acid.
| Compound Name | 3-[(3-decanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165195567 |
| Molecular Formula | C36H60NO10P |
| Molecular Weight | 697.85 g/mol |
| Exact Mass | 697.40 |
| IUPAC Name | 3-[(3-decanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C36H60NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-23-25-27-34(39)37-33(36(41)42)31-47-48(43,44)46-30-32(38)29-45-35(40)28-26-24-21-10-8-6-4-2/h5,7,11-12,14-15,17-18,20,22,32-33,38H,3-4,6,8-10,13,16,19,21,23-31H2,1-2H3,(H,37,39)(H,41,42)(H,43,44)/b7-5-,12-11-,15-14-,18-17-,22-20- |
| InChIKey | CHIZKKLPOIQCNI-YJXIRHGTSA-N |
| XLogP | 7.66 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.85 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|