C58H98NO7P — CID 165195585
[2-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-3-[(10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-10,13,16,19,22,25-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165195585) has the molecular formula C58H98NO7P and a molecular weight of 952.40 g/mol. Its IUPAC name is [2-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-3-[(10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-10,13,16,19,22,25-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-3-[(10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-10,13,16,19,22,25-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165195585 |
| Molecular Formula | C58H98NO7P |
| Molecular Weight | 952.40 g/mol |
| Exact Mass | 951.71 |
| IUPAC Name | [2-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxy-3-[(10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-10,13,16,19,22,25-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C58H98NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-27-28-29-30-31-32-34-36-38-40-42-44-46-48-50-53-63-55-57(56-65-67(61,62)64-54-52-59(3,4)5)66-58(60)51-49-47-45-43-41-39-37-35-33-25-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,26-27,29-30,32-35,57H,6-7,12-13,18-19,24-25,28,31,36-56H2,1-5H3/b10-8-,11-9-,16-14-,17-15-,22-20-,23-21-,27-26-,30-29-,34-32-,35-33- |
| InChIKey | CHKKMEPDOOZLPZ-LARDSWGCSA-N |
| XLogP | 15.87 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.40 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|