About 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate
3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 16519640) has the molecular formula C16H17N3O3S
and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 16519640 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OCCCn2c(=O)[nH]c3ccccc32)s1 |
| InChI | InChI=1S/C16H17N3O3S/c1-10-14(23-11(2)17-10)15(20)22-9-5-8-19-13-7-4-3-6-12(13)18-16(19)21/h3-4,6-7H,5,8-9H2,1-2H3,(H,18,21) |
| InChIKey | HXGUQTCXINSVTO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (CID 16519640) is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate is Cc1nc(C)c(C(=O)OCCCn2c(=O)[nH]c3ccccc32)s1.
What is the InChIKey of 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The InChIKey is HXGUQTCXINSVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S/c1-10-14(23-11(2)17-10)15(20)22-9-5-8-19-13-7-4-3-6-12(13)18-16(19)21/h3-4,6-7H,5,8-9H2,1-2H3,(H,18,21).
What are the key properties of 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate?
3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate has a molecular weight of 331.40 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2,4-dimethyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 16519640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).