C32H60NO8P — CID 165199921
[3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 165199921) has the molecular formula C32H60NO8P and a molecular weight of 617.81 g/mol. Its IUPAC name is [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 165199921 |
| Molecular Formula | C32H60NO8P |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 617.41 |
| IUPAC Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCC |
| InChI | InChI=1S/C32H60NO8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-25-32(36)39-28-30(34)29-41-42(37,38)40-27-26-33-31(35)24-22-6-4-2/h10-11,13-14,30,34H,3-9,12,15-29H2,1-2H3,(H,33,35)(H,37,38)/b11-10-,14-13- |
| InChIKey | CYHNFBDXDLVDGX-XVTLYKPTSA-N |
| XLogP | 7.70 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|