C48H85NO7P+ — CID 165204880
2-[[3-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoxy]-2-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165204880) has the molecular formula C48H85NO7P+ and a molecular weight of 819.18 g/mol. Its IUPAC name is 2-[[3-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoxy]-2-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoxy]-2-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165204880 |
| Molecular Formula | C48H85NO7P+ |
| Molecular Weight | 819.18 g/mol |
| Exact Mass | 818.61 |
| IUPAC Name | 2-[[3-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoxy]-2-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCCCC |
| InChI | InChI=1S/C48H84NO7P/c1-6-8-10-12-14-16-18-20-22-23-24-25-26-27-28-29-31-33-35-37-39-41-48(50)56-47(46-55-57(51,52)54-44-42-49(3,4)5)45-53-43-40-38-36-34-32-30-21-19-17-15-13-11-9-7-2/h9,11,15,17-18,20-21,23-24,26-27,30,34,36,47H,6-8,10,12-14,16,19,22,25,28-29,31-33,35,37-46H2,1-5H3/p+1/b11-9-,17-15-,20-18-,24-23-,27-26-,30-21-,36-34- |
| InChIKey | DSDSNOILIRTZEK-FXKXQSBUSA-O |
| XLogP | 13.27 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.18 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|