C56H96O6 — CID 165205317
[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 165205317) has the molecular formula C56H96O6 and a molecular weight of 865.38 g/mol. Its IUPAC name is [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 165205317 |
| Molecular Formula | C56H96O6 |
| Molecular Weight | 865.38 g/mol |
| Exact Mass | 864.72 |
| IUPAC Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCC)COC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C56H96O6/c1-4-7-10-13-16-19-22-25-26-27-28-29-30-32-34-37-40-43-46-49-55(58)61-52-53(51-60-54(57)48-45-42-39-36-33-24-21-18-15-12-9-6-3)62-56(59)50-47-44-41-38-35-31-23-20-17-14-11-8-5-2/h11,14,16,18-21,23,25-26,28-29,53H,4-10,12-13,15,17,22,24,27,30-52H2,1-3H3/b14-11-,19-16-,21-18-,23-20-,26-25-,29-28- |
| InChIKey | DTUCIVBTEIZMDA-WKDJUGFPSA-N |
| XLogP | 17.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.38 |
| LogP ≤ 5 | 17.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|