C40H78NO12P — CID 165206002
[3-hydroxy-2-[[(Z)-3-hydroxydocos-11-enoyl]amino]dodecyl] (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate (PubChem CID 165206002) has the molecular formula C40H78NO12P and a molecular weight of 796.03 g/mol. Its IUPAC name is [3-hydroxy-2-[[(Z)-3-hydroxydocos-11-enoyl]amino]dodecyl] (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate.
| Compound Name | [3-hydroxy-2-[[(Z)-3-hydroxydocos-11-enoyl]amino]dodecyl] (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 165206002 |
| Molecular Formula | C40H78NO12P |
| Molecular Weight | 796.03 g/mol |
| Exact Mass | 795.53 |
| IUPAC Name | [3-hydroxy-2-[[(Z)-3-hydroxydocos-11-enoyl]amino]dodecyl] (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCC(O)CC(=O)NC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)C(O)CCCCCCCCC |
| InChI | InChI=1S/C40H78NO12P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-23-25-27-31(42)29-34(44)41-32(33(43)28-26-24-21-10-8-6-4-2)30-52-54(50,51)53-40-38(48)36(46)35(45)37(47)39(40)49/h16-17,31-33,35-40,42-43,45-49H,3-15,18-30H2,1-2H3,(H,41,44)(H,50,51)/b17-16- |
| InChIKey | DWQZEMOBMGLMHT-MSUUIHNZSA-N |
| XLogP | 5.86 |
| TPSA | 226.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.03 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|