C21H19N3O4S — CID 16520816
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-acetamidobenzoate (PubChem CID 16520816) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-acetamidobenzoate.
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 16520816 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OC(C)C(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C21H19N3O4S/c1-13(28-20(27)16-8-10-17(11-9-16)22-14(2)25)19(26)24-21-23-18(12-29-21)15-6-4-3-5-7-15/h3-13H,1-2H3,(H,22,25)(H,23,24,26) |
| InChIKey | KRWVIFJCNMRGHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |