C19H38NO8P — CID 165219747
[3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] heptanoate (PubChem CID 165219747) has the molecular formula C19H38NO8P and a molecular weight of 439.49 g/mol. Its IUPAC name is [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] heptanoate.
| Compound Name | [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] heptanoate |
|---|---|
| PubChem CID | 165219747 |
| Molecular Formula | C19H38NO8P |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [3-[2-(heptanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] heptanoate |
| SMILES | CCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCC |
| InChI | InChI=1S/C19H38NO8P/c1-3-5-7-9-11-18(22)20-13-14-27-29(24,25)28-16-17(21)15-26-19(23)12-10-8-6-4-2/h17,21H,3-16H2,1-2H3,(H,20,22)(H,24,25) |
| InChIKey | GZPYUEWUQHPFIP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|