C48H84O12S — CID 165221998
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z)-henicosa-11,14-dienoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 165221998) has the molecular formula C48H84O12S and a molecular weight of 885.25 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z)-henicosa-11,14-dienoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z)-henicosa-11,14-dienoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 165221998 |
| Molecular Formula | C48H84O12S |
| Molecular Weight | 885.25 g/mol |
| Exact Mass | 884.57 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(11Z,14Z)-henicosa-11,14-dienoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\C/C=C\CCCCCC)COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O |
| InChI | InChI=1S/C48H84O12S/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-36-38-56-40-42(41-57-48-46(52)47(60-61(53,54)55)45(51)43(39-49)59-48)58-44(50)37-35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h6,8,12-15,18-20,23,42-43,45-49,51-52H,3-5,7,9-11,16-17,21-22,24-41H2,1-2H3,(H,53,54,55)/b8-6-,14-12-,15-13-,20-19-,23-18- |
| InChIKey | HITMOSDRGOYDDJ-VEABRXOCSA-N |
| XLogP | 10.13 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.25 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|