C20H17IN2O3S — CID 16522241
[2-(N-acetyl-3-methylanilino)-1,3-thiazol-4-yl]methyl 3-iodobenzoate (PubChem CID 16522241) has the molecular formula C20H17IN2O3S and a molecular weight of 492.34 g/mol. Its IUPAC name is [2-(N-acetyl-3-methylanilino)-1,3-thiazol-4-yl]methyl 3-iodobenzoate.
| Compound Name | [2-(N-acetyl-3-methylanilino)-1,3-thiazol-4-yl]methyl 3-iodobenzoate |
|---|---|
| PubChem CID | 16522241 |
| Molecular Formula | C20H17IN2O3S |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | [2-(N-acetyl-3-methylanilino)-1,3-thiazol-4-yl]methyl 3-iodobenzoate |
| SMILES | CC(=O)N(c1cccc(C)c1)c1nc(COC(=O)c2cccc(I)c2)cs1 |
| InChI | InChI=1S/C20H17IN2O3S/c1-13-5-3-8-18(9-13)23(14(2)24)20-22-17(12-27-20)11-26-19(25)15-6-4-7-16(21)10-15/h3-10,12H,11H2,1-2H3 |
| InChIKey | BBCOCJPIONORRC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|