C47H84NO7P — CID 165239848
[3-[(Z)-pentadec-9-enoxy]-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165239848) has the molecular formula C47H84NO7P and a molecular weight of 806.16 g/mol. Its IUPAC name is [3-[(Z)-pentadec-9-enoxy]-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-pentadec-9-enoxy]-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165239848 |
| Molecular Formula | C47H84NO7P |
| Molecular Weight | 806.16 g/mol |
| Exact Mass | 805.60 |
| IUPAC Name | [3-[(Z)-pentadec-9-enoxy]-2-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C47H84NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-47(49)55-46(45-54-56(50,51)53-43-41-48(3,4)5)44-52-42-39-37-35-33-31-29-19-17-15-13-11-9-7-2/h8,10,14-17,20-21,23-24,26-27,46H,6-7,9,11-13,18-19,22,25,28-45H2,1-5H3/b10-8-,16-14-,17-15-,21-20-,24-23-,27-26- |
| InChIKey | KBBBPCBXHHEYHB-HEPKMYIXSA-N |
| XLogP | 12.47 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.16 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|