C40H71NO7P+ — CID 165240136
2-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165240136) has the molecular formula C40H71NO7P+ and a molecular weight of 708.98 g/mol. Its IUPAC name is 2-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165240136 |
| Molecular Formula | C40H71NO7P+ |
| Molecular Weight | 708.98 g/mol |
| Exact Mass | 708.50 |
| IUPAC Name | 2-[[3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C40H70NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-35-45-37-39(38-47-49(43,44)46-36-34-41(3,4)5)48-40(42)33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,39H,6-7,12-13,18-19,24-38H2,1-5H3/p+1/b10-8-,11-9-,16-14-,17-15-,22-20-,23-21- |
| InChIKey | KCFRKDGGUQDTSU-RSLAUBRISA-O |
| XLogP | 10.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.98 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|