About [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate
[1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate (PubChem CID 16525190) has the molecular formula C13H14Cl2N2O3
and a molecular weight of 317.17 g/mol. Its IUPAC name is [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate |
| PubChem CID | 16525190 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate |
| SMILES | CC(OC(=O)C1CC1C)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-6-3-9(6)13(19)20-7(2)12(18)17-11-10(15)4-8(14)5-16-11/h4-7,9H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | WKNTVUYLRMTBRX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate?
The IUPAC name of [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate (CID 16525190) is [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate.
What is the SMILES notation for [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate?
The canonical SMILES for [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate is CC(OC(=O)C1CC1C)C(=O)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate?
The InChIKey is WKNTVUYLRMTBRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O3/c1-6-3-9(6)13(19)20-7(2)12(18)17-11-10(15)4-8(14)5-16-11/h4-7,9H,3H2,1-2H3,(H,16,17,18).
What are the key properties of [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate?
[1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate has a molecular weight of 317.17 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 16525190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).