C14H16FNO3 — CID 16526221
(2-amino-2-oxoethyl) 1-(3-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 16526221) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 1-(3-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 1-(3-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 16526221 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2-amino-2-oxoethyl) 1-(3-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | NC(=O)COC(=O)C1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C14H16FNO3/c15-11-5-3-4-10(8-11)14(6-1-2-7-14)13(18)19-9-12(16)17/h3-5,8H,1-2,6-7,9H2,(H2,16,17) |
| InChIKey | OVHNOZPRBBGWDX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |