C40H75N2O6P — CID 165272020
2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165272020) has the molecular formula C40H75N2O6P and a molecular weight of 711.02 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165272020 |
| Molecular Formula | C40H75N2O6P |
| Molecular Weight | 711.02 g/mol |
| Exact Mass | 710.54 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CCCCCCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCCN)NC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H75N2O6P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(43)38(37-48-49(45,46)47-36-35-41)42-40(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h15,17-18,20,23,25,31,33,38-39,43H,3-14,16,19,21-22,24,26-30,32,34-37,41H2,1-2H3,(H,42,44)(H,45,46)/b17-15+,20-18-,25-23+,33-31+ |
| InChIKey | OZMJENVEQAXZKU-PQXPCXJPSA-N |
| XLogP | 10.55 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.02 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|