C18H16ClN3O3S — CID 16527327
[2-oxo-2-(prop-2-enylamino)ethyl] 1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 16527327) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16527327 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1cc2c(C)nn(-c3ccccc3Cl)c2s1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-3-8-20-16(23)10-25-18(24)15-9-12-11(2)21-22(17(12)26-15)14-7-5-4-6-13(14)19/h3-7,9H,1,8,10H2,2H3,(H,20,23) |
| InChIKey | AXDXGWSWGWYYNV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|