C43H76NO7P — CID 165273811
[2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(Z)-pentadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165273811) has the molecular formula C43H76NO7P and a molecular weight of 750.06 g/mol. Its IUPAC name is [2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(Z)-pentadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(Z)-pentadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165273811 |
| Molecular Formula | C43H76NO7P |
| Molecular Weight | 750.06 g/mol |
| Exact Mass | 749.54 |
| IUPAC Name | [2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(Z)-pentadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(COCCCCCCCC/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C43H76NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-36-43(45)51-42(41-50-52(46,47)49-39-37-44(3,4)5)40-48-38-35-33-31-29-27-25-19-17-15-13-11-9-7-2/h8,10,14-17,20-21,23-24,28,30,42H,6-7,9,11-13,18-19,22,25-27,29,31-41H2,1-5H3/b10-8-,16-14-,17-15-,21-20-,24-23-,30-28- |
| InChIKey | PGLZOPOYHKOBOD-NAPRHVAASA-N |
| XLogP | 10.91 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.06 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|