C21H22N2O8S — CID 16527597
[2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 16527597) has the molecular formula C21H22N2O8S and a molecular weight of 462.48 g/mol. Its IUPAC name is [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16527597 |
| Molecular Formula | C21H22N2O8S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)NC(=O)COC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O8S/c1-29-17-6-2-15(3-7-17)20(25)22-19(24)14-31-21(26)16-4-8-18(9-5-16)32(27,28)23-10-12-30-13-11-23/h2-9H,10-14H2,1H3,(H,22,24,25) |
| InChIKey | ZTDRFGRPCVCKJW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |