C52H94O6 — CID 165281138
2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl (Z)-heptadec-9-enoate (PubChem CID 165281138) has the molecular formula C52H94O6 and a molecular weight of 815.32 g/mol. Its IUPAC name is 2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl (Z)-heptadec-9-enoate.
| Compound Name | 2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 165281138 |
| Molecular Formula | C52H94O6 |
| Molecular Weight | 815.32 g/mol |
| Exact Mass | 814.71 |
| IUPAC Name | 2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl (Z)-heptadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C52H94O6/c1-4-7-10-13-16-19-22-25-28-30-33-36-39-42-45-51(54)57-48-49(58-52(55)46-43-40-37-34-31-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h20-25,49H,4-19,26-48H2,1-3H3/b23-20-,24-21-,25-22- |
| InChIKey | QJJXGOJKLTYZHP-GGDBOESOSA-N |
| XLogP | 16.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.32 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|