C20H13ClF2N2O4S — CID 16528257
[2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 16528257) has the molecular formula C20H13ClF2N2O4S and a molecular weight of 450.85 g/mol. Its IUPAC name is [2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 16528257 |
| Molecular Formula | C20H13ClF2N2O4S |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [2-[3-(furan-2-yl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(OCC(=O)N1N=C(c2cccs2)CC1c1ccco1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H13ClF2N2O4S/c21-12-8-14(23)13(22)7-11(12)20(27)29-10-19(26)25-16(17-3-1-5-28-17)9-15(24-25)18-4-2-6-30-18/h1-8,16H,9-10H2 |
| InChIKey | UEWMZQFQQBJYKY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|