C19H19ClF2N2O5S — CID 16528277
[1-[5-(dimethylsulfamoyl)-2-methylanilino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 16528277) has the molecular formula C19H19ClF2N2O5S and a molecular weight of 460.89 g/mol. Its IUPAC name is [1-[5-(dimethylsulfamoyl)-2-methylanilino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [1-[5-(dimethylsulfamoyl)-2-methylanilino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 16528277 |
| Molecular Formula | C19H19ClF2N2O5S |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | [1-[5-(dimethylsulfamoyl)-2-methylanilino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)C(C)OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H19ClF2N2O5S/c1-10-5-6-12(30(27,28)24(3)4)7-17(10)23-18(25)11(2)29-19(26)13-8-15(21)16(22)9-14(13)20/h5-9,11H,1-4H3,(H,23,25) |
| InChIKey | BKMRWRJOPOHLKO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|