C12H22NO10P — CID 165296817
3-[hydroxy-(2-hydroxy-3-propanoyloxypropoxy)phosphoryl]oxy-2-(propanoylamino)propanoic acid (PubChem CID 165296817) has the molecular formula C12H22NO10P and a molecular weight of 371.28 g/mol. Its IUPAC name is 3-[hydroxy-(2-hydroxy-3-propanoyloxypropoxy)phosphoryl]oxy-2-(propanoylamino)propanoic acid.
| Compound Name | 3-[hydroxy-(2-hydroxy-3-propanoyloxypropoxy)phosphoryl]oxy-2-(propanoylamino)propanoic acid |
|---|---|
| PubChem CID | 165296817 |
| Molecular Formula | C12H22NO10P |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 3-[hydroxy-(2-hydroxy-3-propanoyloxypropoxy)phosphoryl]oxy-2-(propanoylamino)propanoic acid |
| SMILES | CCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CC)C(=O)O |
| InChI | InChI=1S/C12H22NO10P/c1-3-10(15)13-9(12(17)18)7-23-24(19,20)22-6-8(14)5-21-11(16)4-2/h8-9,14H,3-7H2,1-2H3,(H,13,15)(H,17,18)(H,19,20) |
| InChIKey | SSXHIWBFXCEYJG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|