About [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate
[1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate (PubChem CID 16530422) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate |
| PubChem CID | 16530422 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-14-8-11-17(12-9-14)20-19(22)15(2)23-18(21)13-10-16-6-4-3-5-7-16/h8-9,11-12,15-16H,3-7,10,13H2,1-2H3,(H,20,22) |
| InChIKey | DRPYVUHOPRMPCW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate?
The IUPAC name of [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate (CID 16530422) is [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate.
What is the SMILES notation for [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate?
The canonical SMILES for [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate is Cc1ccc(NC(=O)C(C)OC(=O)CCC2CCCCC2)cc1.
What is the InChIKey of [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate?
The InChIKey is DRPYVUHOPRMPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-14-8-11-17(12-9-14)20-19(22)15(2)23-18(21)13-10-16-6-4-3-5-7-16/h8-9,11-12,15-16H,3-7,10,13H2,1-2H3,(H,20,22).
What are the key properties of [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate?
[1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate has a molecular weight of 317.43 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methylanilino)-1-oxopropan-2-yl] 3-cyclohexylpropanoate is sourced from PubChem (CID 16530422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).