C36H73NO7P+ — CID 165310192
2-[hydroxy-[2-[(Z)-nonadec-9-enoyl]oxy-3-nonoxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165310192) has the molecular formula C36H73NO7P+ and a molecular weight of 662.95 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(Z)-nonadec-9-enoyl]oxy-3-nonoxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(Z)-nonadec-9-enoyl]oxy-3-nonoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165310192 |
| Molecular Formula | C36H73NO7P+ |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 662.51 |
| IUPAC Name | 2-[hydroxy-[2-[(Z)-nonadec-9-enoyl]oxy-3-nonoxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C36H72NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-27-29-36(38)44-35(33-41-31-28-26-24-13-11-9-7-2)34-43-45(39,40)42-32-30-37(3,4)5/h18-19,35H,6-17,20-34H2,1-5H3/p+1/b19-18- |
| InChIKey | VNSXQDKPRGDOFV-HNENSFHCSA-O |
| XLogP | 9.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|