C42H76NO9P — CID 165312761
2-amino-3-[[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-icos-11-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165312761) has the molecular formula C42H76NO9P and a molecular weight of 770.04 g/mol. Its IUPAC name is 2-amino-3-[[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-icos-11-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-icos-11-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165312761 |
| Molecular Formula | C42H76NO9P |
| Molecular Weight | 770.04 g/mol |
| Exact Mass | 769.53 |
| IUPAC Name | 2-amino-3-[[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-icos-11-enoxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C42H76NO9P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-35-49-36-39(37-50-53(47,48)51-38-40(43)42(45)46)52-41(44)34-32-30-28-26-24-22-16-14-12-10-8-6-4-2/h6,8,12,14,17-18,22,24,39-40H,3-5,7,9-11,13,15-16,19-21,23,25-38,43H2,1-2H3,(H,45,46)(H,47,48)/b8-6-,14-12-,18-17-,24-22- |
| InChIKey | VYJLCICRKDLLLK-FJCSZYFGSA-N |
| XLogP | 11.09 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.04 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|