C14H9Cl2F3N4O3 — CID 16531584
2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 16531584) has the molecular formula C14H9Cl2F3N4O3 and a molecular weight of 409.15 g/mol. Its IUPAC name is 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 16531584 |
| Molecular Formula | C14H9Cl2F3N4O3 |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 2-[[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(Cn1ncc(Cl)c(Cl)c1=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9Cl2F3N4O3/c15-6-3-21-23(14(26)11(6)16)5-10(25)20-4-9(24)22-8-2-1-7(17)12(18)13(8)19/h1-3H,4-5H2,(H,20,25)(H,22,24) |
| InChIKey | FVXRCARKRAJCJU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|