C47H89O12P — CID 165321510
[1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate (PubChem CID 165321510) has the molecular formula C47H89O12P and a molecular weight of 877.19 g/mol. Its IUPAC name is [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 165321510 |
| Molecular Formula | C47H89O12P |
| Molecular Weight | 877.19 g/mol |
| Exact Mass | 876.61 |
| IUPAC Name | [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C47H89O12P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-41(48)58-40(39-57-60(54,55)59-47-45(52)43(50)42(49)44(51)46(47)53)38-56-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h17-20,40,42-47,49-53H,3-16,21-39H2,1-2H3,(H,54,55)/b19-17-,20-18- |
| InChIKey | XHHIHBISFWCBNM-CLFAGFIQSA-N |
| XLogP | 10.09 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.19 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|