C43H68O12S — CID 165328405
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate (PubChem CID 165328405) has the molecular formula C43H68O12S and a molecular weight of 809.07 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 165328405 |
| Molecular Formula | C43H68O12S |
| Molecular Weight | 809.07 g/mol |
| Exact Mass | 808.44 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C43H68O12S/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-51-35-37(36-52-43-41(47)42(55-56(48,49)50)40(46)38(34-44)54-43)53-39(45)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h5-8,11-14,17-18,20-23,26,28,37-38,40-44,46-47H,3-4,9-10,15-16,19,24-25,27,29-36H2,1-2H3,(H,48,49,50)/b7-5-,8-6-,13-11-,14-12-,18-17-,22-20-,23-21-,28-26- |
| InChIKey | YIPLZGGVIBZNOM-WKASEKAZSA-N |
| XLogP | 7.51 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.07 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|