C53H90NO9P — CID 165329362
2-amino-3-[[3-[(Z)-henicos-11-enoxy]-2-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165329362) has the molecular formula C53H90NO9P and a molecular weight of 916.27 g/mol. Its IUPAC name is 2-amino-3-[[3-[(Z)-henicos-11-enoxy]-2-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-[(Z)-henicos-11-enoxy]-2-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165329362 |
| Molecular Formula | C53H90NO9P |
| Molecular Weight | 916.27 g/mol |
| Exact Mass | 915.64 |
| IUPAC Name | 2-amino-3-[[3-[(Z)-henicos-11-enoxy]-2-[(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C53H90NO9P/c1-3-5-7-9-11-13-15-17-19-21-23-24-25-26-27-29-31-33-35-37-39-41-43-45-52(55)63-50(48-61-64(58,59)62-49-51(54)53(56)57)47-60-46-44-42-40-38-36-34-32-30-28-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17,19-20,22-24,26-27,31,33,37,39,50-51H,3-4,6,8-10,12,14-16,18,21,25,28-30,32,34-36,38,40-49,54H2,1-2H3,(H,56,57)(H,58,59)/b7-5-,13-11-,19-17-,22-20-,24-23-,27-26-,33-31-,39-37- |
| InChIKey | YMGQBTMWORWHLC-DTHFXYLSSA-N |
| XLogP | 14.48 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.27 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|