C25H29N3O3S — CID 16533166
N-butyl-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide (PubChem CID 16533166) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-butyl-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-butyl-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16533166 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-butyl-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)CSC1=N/C(=C\c2ccc(OC)cc2)C(=O)N1c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H29N3O3S/c1-5-6-11-26-23(29)16-32-25-27-22(15-19-7-9-21(31-4)10-8-19)24(30)28(25)20-13-17(2)12-18(3)14-20/h7-10,12-15H,5-6,11,16H2,1-4H3,(H,26,29)/b22-15- |
| InChIKey | MMGWKZKLEBLTNR-JCMHNJIXSA-N |
| XLogP | 4.71 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|