C40H73NO7P+ — CID 165335933
2-[hydroxy-[2-octanoyloxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165335933) has the molecular formula C40H73NO7P+ and a molecular weight of 711.00 g/mol. Its IUPAC name is 2-[hydroxy-[2-octanoyloxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-octanoyloxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165335933 |
| Molecular Formula | C40H73NO7P+ |
| Molecular Weight | 711.00 g/mol |
| Exact Mass | 710.51 |
| IUPAC Name | 2-[hydroxy-[2-octanoyloxy-3-[(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC |
| InChI | InChI=1S/C40H72NO7P/c1-6-8-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-30-32-35-45-37-39(48-40(42)33-31-29-11-9-7-2)38-47-49(43,44)46-36-34-41(3,4)5/h8,10,13-14,16-17,19-20,22-23,39H,6-7,9,11-12,15,18,21,24-38H2,1-5H3/p+1/b10-8-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | ZMTHQLRKECENCM-MFPUCXCHSA-O |
| XLogP | 10.60 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.00 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|