C19H17ClN2O3S — CID 16533688
[1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 16533688) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 16533688 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(OC(=O)CCSc1ccc(Cl)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H17ClN2O3S/c1-13(19(24)22-16-4-2-3-14(11-16)12-21)25-18(23)9-10-26-17-7-5-15(20)6-8-17/h2-8,11,13H,9-10H2,1H3,(H,22,24) |
| InChIKey | QIUWFVFOAZRBCP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |