C47H88O15P2 — CID 165338364
[2-hydroxy-3-[hydroxy-[2-hydroxy-3-[hydroxy-[2-hydroxy-3-[(10E,12E)-octadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxypropoxy]phosphoryl]oxypropyl] (E)-icos-11-enoate (PubChem CID 165338364) has the molecular formula C47H88O15P2 and a molecular weight of 955.15 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-hydroxy-3-[hydroxy-[2-hydroxy-3-[(10E,12E)-octadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxypropoxy]phosphoryl]oxypropyl] (E)-icos-11-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-hydroxy-3-[hydroxy-[2-hydroxy-3-[(10E,12E)-octadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxypropoxy]phosphoryl]oxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 165338364 |
| Molecular Formula | C47H88O15P2 |
| Molecular Weight | 955.15 g/mol |
| Exact Mass | 954.56 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-hydroxy-3-[hydroxy-[2-hydroxy-3-[(10E,12E)-octadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxypropoxy]phosphoryl]oxypropyl] (E)-icos-11-enoate |
| SMILES | CCCCC/C=C/C=C/CCCCCCCCC(=O)OCC(O)COP(=O)(O)OCC(O)COP(=O)(O)OCC(O)COC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C47H88O15P2/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-47(52)58-38-44(49)40-60-64(55,56)62-42-45(50)41-61-63(53,54)59-39-43(48)37-57-46(51)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h12,14,16-19,43-45,48-50H,3-11,13,15,20-42H2,1-2H3,(H,53,54)(H,55,56)/b14-12+,18-16+,19-17+ |
| InChIKey | ZWPPLQSNQFVCRC-IGAWMMDQSA-N |
| XLogP | 11.05 |
| TPSA | 224.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.15 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|