About 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate
1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate (PubChem CID 165339298) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate.
Molecular Properties
| Compound Name | 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate |
| PubChem CID | 165339298 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate |
| SMILES | C[N+](C)(C)CC[O-].O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C5H13NO.C4H4N2O2/c1-6(2,3)4-5-7;7-3-1-2-4(8)6-5-3/h4-5H2,1-3H3;1-2H,(H,5,7)(H,6,8) |
| InChIKey | FTQMQLYMIBFCFR-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate?
The IUPAC name of 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate (CID 165339298) is 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate.
What is the SMILES notation for 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate?
The canonical SMILES for 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate is C[N+](C)(C)CC[O-].O=c1ccc(=O)[nH][nH]1.
What is the InChIKey of 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate?
The InChIKey is FTQMQLYMIBFCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO.C4H4N2O2/c1-6(2,3)4-5-7;7-3-1-2-4(8)6-5-3/h4-5H2,1-3H3;1-2H,(H,5,7)(H,6,8).
What are the key properties of 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate?
1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate has a molecular weight of 215.25 g/mol, XLogP of -1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridazine-3,6-dione;2-(trimethylazaniumyl)ethanolate is sourced from PubChem (CID 165339298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).