About 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide
1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide (PubChem CID 165339994) has the molecular formula C12H20INO
and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide.
Molecular Properties
| Compound Name | 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide |
| PubChem CID | 165339994 |
| Molecular Formula | C12H20INO |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide |
| SMILES | CC(=O)C1=CCC[C@@H]2CC[C@H]1[N+]2(C)C.[I-] |
| InChI | InChI=1S/C12H20NO.HI/c1-9(14)11-6-4-5-10-7-8-12(11)13(10,2)3;/h6,10,12H,4-5,7-8H2,1-3H3;1H/q+1;/p-1/t10-,12-;/m1./s1 |
| InChIKey | ULFPCIFJWKJUKE-MHDYBILJSA-M |
| XLogP | -1.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide?
The IUPAC name of 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide (CID 165339994) is 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide.
What is the SMILES notation for 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide?
The canonical SMILES for 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide is CC(=O)C1=CCC[C@@H]2CC[C@H]1[N+]2(C)C.[I-].
What is the InChIKey of 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide?
The InChIKey is ULFPCIFJWKJUKE-MHDYBILJSA-M. The full InChI is InChI=1S/C12H20NO.HI/c1-9(14)11-6-4-5-10-7-8-12(11)13(10,2)3;/h6,10,12H,4-5,7-8H2,1-3H3;1H/q+1;/p-1/t10-,12-;/m1./s1.
What are the key properties of 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide?
1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide has a molecular weight of 321.20 g/mol, XLogP of -1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,6R)-9,9-dimethyl-9-azoniabicyclo[4.2.1]non-2-en-2-yl]ethanone iodide is sourced from PubChem (CID 165339994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).