C12H20ClNO8 — CID 165340144
methyl 5-acetamido-2-chloro-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate (PubChem CID 165340144) has the molecular formula C12H20ClNO8 and a molecular weight of 341.74 g/mol. Its IUPAC name is methyl 5-acetamido-2-chloro-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 5-acetamido-2-chloro-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 165340144 |
| Molecular Formula | C12H20ClNO8 |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | methyl 5-acetamido-2-chloro-4-hydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(Cl)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O1 |
| InChI | InChI=1S/C12H20ClNO8/c1-5(16)14-8-6(17)3-12(13,11(20)21-2)22-10(8)9(19)7(18)4-15/h6-10,15,17-19H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | IHUDXNFXENVHTI-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|