C17H24N2O4 — CID 165340759
tert-butyl N-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]ethyl]carbamate (PubChem CID 165340759) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 165340759 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | tert-butyl N-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]ethyl]carbamate |
| SMILES | COc1ccc(C=CC(=O)NCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(2,3)23-16(21)19-12-11-18-15(20)10-7-13-5-8-14(22-4)9-6-13/h5-10H,11-12H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | VWWUUHHFJBFQRG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|