C46H53NO7 — CID 165340806
benzyl N-butyl-N-[(2S,3R,4S,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexyl]carbamate (PubChem CID 165340806) has the molecular formula C46H53NO7 and a molecular weight of 731.93 g/mol. Its IUPAC name is benzyl N-butyl-N-[(2S,3R,4S,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexyl]carbamate.
| Compound Name | benzyl N-butyl-N-[(2S,3R,4S,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 165340806 |
| Molecular Formula | C46H53NO7 |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.38 |
| IUPAC Name | benzyl N-butyl-N-[(2S,3R,4S,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexyl]carbamate |
| SMILES | CCCCN(C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C46H53NO7/c1-2-3-29-47(46(49)54-35-41-27-17-8-18-28-41)30-43(51-32-38-21-11-5-12-22-38)45(53-34-40-25-15-7-16-26-40)44(52-33-39-23-13-6-14-24-39)42(48)36-50-31-37-19-9-4-10-20-37/h4-28,42-45,48H,2-3,29-36H2,1H3/t42-,43+,44+,45-/m1/s1 |
| InChIKey | UAKGFXZUFKHJIX-JXXXVXAQSA-N |
| XLogP | 8.76 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |