C37H26Cl5NO5 — CID 165341076
(2,3,4,5,6-pentachlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 165341076) has the molecular formula C37H26Cl5NO5 and a molecular weight of 741.88 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 165341076 |
| Molecular Formula | C37H26Cl5NO5 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 739.03 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | O=C(N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H26Cl5NO5/c38-30-31(39)33(41)35(34(42)32(30)40)48-36(44)29(18-21-14-16-23(17-15-21)46-19-22-8-2-1-3-9-22)43-37(45)47-20-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h1-17,28-29H,18-20H2,(H,43,45)/t29-/m0/s1 |
| InChIKey | BQOVNJMNVNBLMW-LJAQVGFWSA-N |
| XLogP | 10.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|