C10H17NO4 — CID 165341663
(1,3,5,7-tetramethyl-2,4,6,8-tetraoxatricyclo[3.3.1.03,7]nonan-9-yl)methanamine (PubChem CID 165341663) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1,3,5,7-tetramethyl-2,4,6,8-tetraoxatricyclo[3.3.1.03,7]nonan-9-yl)methanamine.
| Compound Name | (1,3,5,7-tetramethyl-2,4,6,8-tetraoxatricyclo[3.3.1.03,7]nonan-9-yl)methanamine |
|---|---|
| PubChem CID | 165341663 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (1,3,5,7-tetramethyl-2,4,6,8-tetraoxatricyclo[3.3.1.03,7]nonan-9-yl)methanamine |
| SMILES | CC12OC3(C)OC(C)(OC3(C)O1)C2CN |
| InChI | InChI=1S/C10H17NO4/c1-7-6(5-11)8(2)14-9(3,12-7)10(4,13-7)15-8/h6H,5,11H2,1-4H3 |
| InChIKey | FIJUJDUTSQDEOP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |